C24H20O9 — CID 162782627
bis[4-(oxiran-2-ylmethoxy)phenyl] furan-2,5-dicarboxylate (PubChem CID 162782627) has the molecular formula C24H20O9 and a molecular weight of 452.42 g/mol. Its IUPAC name is bis[4-(oxiran-2-ylmethoxy)phenyl] furan-2,5-dicarboxylate.
| Compound Name | bis[4-(oxiran-2-ylmethoxy)phenyl] furan-2,5-dicarboxylate |
|---|---|
| PubChem CID | 162782627 |
| Molecular Formula | C24H20O9 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | bis[4-(oxiran-2-ylmethoxy)phenyl] furan-2,5-dicarboxylate |
| SMILES | O=C(Oc1ccc(OCC2CO2)cc1)c1ccc(C(=O)Oc2ccc(OCC3CO3)cc2)o1 |
| InChI | InChI=1S/C24H20O9/c25-23(31-17-5-1-15(2-6-17)27-11-19-13-29-19)21-9-10-22(33-21)24(26)32-18-7-3-16(4-8-18)28-12-20-14-30-20/h1-10,19-20H,11-14H2 |
| InChIKey | QJYSUEKAVNBNNN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|