C23H19NO9 — CID 162782624
bis[4-(oxiran-2-ylmethoxy)phenyl] 1,2-oxazole-3,5-dicarboxylate (PubChem CID 162782624) has the molecular formula C23H19NO9 and a molecular weight of 453.40 g/mol. Its IUPAC name is bis[4-(oxiran-2-ylmethoxy)phenyl] 1,2-oxazole-3,5-dicarboxylate.
| Compound Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 1,2-oxazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 162782624 |
| Molecular Formula | C23H19NO9 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 1,2-oxazole-3,5-dicarboxylate |
| SMILES | O=C(Oc1ccc(OCC2CO2)cc1)c1cc(C(=O)Oc2ccc(OCC3CO3)cc2)on1 |
| InChI | InChI=1S/C23H19NO9/c25-22(31-16-5-1-14(2-6-16)27-10-18-12-29-18)20-9-21(33-24-20)23(26)32-17-7-3-15(4-8-17)28-11-19-13-30-19/h1-9,18-19H,10-13H2 |
| InChIKey | CJQFDYBRLSNWOF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 122.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|