C23H20N2O8 — CID 166979257
5-O-[4-[2-(oxiran-2-yl)ethyl]phenyl] 2-O-[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-oxadiazole-2,5-dicarboxylate (PubChem CID 166979257) has the molecular formula C23H20N2O8 and a molecular weight of 452.42 g/mol. Its IUPAC name is 5-O-[4-[2-(oxiran-2-yl)ethyl]phenyl] 2-O-[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-oxadiazole-2,5-dicarboxylate.
| Compound Name | 5-O-[4-[2-(oxiran-2-yl)ethyl]phenyl] 2-O-[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-oxadiazole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 166979257 |
| Molecular Formula | C23H20N2O8 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 5-O-[4-[2-(oxiran-2-yl)ethyl]phenyl] 2-O-[4-(oxiran-2-ylmethoxy)phenyl] 1,3,4-oxadiazole-2,5-dicarboxylate |
| SMILES | O=C(Oc1ccc(CCC2CO2)cc1)c1nnc(C(=O)Oc2ccc(OCC3CO3)cc2)o1 |
| InChI | InChI=1S/C23H20N2O8/c26-22(31-16-4-1-14(2-5-16)3-6-18-11-29-18)20-24-25-21(33-20)23(27)32-17-9-7-15(8-10-17)28-12-19-13-30-19/h1-2,4-5,7-10,18-19H,3,6,11-13H2 |
| InChIKey | PCXMSIWVUNWPFZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 125.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|