C28H26O10 — CID 101169142
bis[4-(oxiran-2-ylmethoxy)phenyl] 2,5-dimethoxybenzene-1,4-dicarboxylate (PubChem CID 101169142) has the molecular formula C28H26O10 and a molecular weight of 522.51 g/mol. Its IUPAC name is bis[4-(oxiran-2-ylmethoxy)phenyl] 2,5-dimethoxybenzene-1,4-dicarboxylate.
| Compound Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 2,5-dimethoxybenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101169142 |
| Molecular Formula | C28H26O10 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | bis[4-(oxiran-2-ylmethoxy)phenyl] 2,5-dimethoxybenzene-1,4-dicarboxylate |
| SMILES | COc1cc(C(=O)Oc2ccc(OCC3CO3)cc2)c(OC)cc1C(=O)Oc1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C28H26O10/c1-31-25-11-24(28(30)38-20-9-5-18(6-10-20)34-14-22-16-36-22)26(32-2)12-23(25)27(29)37-19-7-3-17(4-8-19)33-13-21-15-35-21/h3-12,21-22H,13-16H2,1-2H3 |
| InChIKey | BPPISJHDEFNSBK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|