C12H11F3O4 — CID 118002356
methyl 4-[[(2S)-oxiran-2-yl]methoxy]-2-(trifluoromethyl)benzoate (PubChem CID 118002356) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is methyl 4-[[(2S)-oxiran-2-yl]methoxy]-2-(trifluoromethyl)benzoate.
| Compound Name | methyl 4-[[(2S)-oxiran-2-yl]methoxy]-2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118002356 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | methyl 4-[[(2S)-oxiran-2-yl]methoxy]-2-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(OC[C@@H]2CO2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3O4/c1-17-11(16)9-3-2-7(18-5-8-6-19-8)4-10(9)12(13,14)15/h2-4,8H,5-6H2,1H3/t8-/m1/s1 |
| InChIKey | CGMNVTXDMXPONQ-MRVPVSSYSA-N |
| XLogP | 2.27 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|