C14H17F3O2 — CID 91501744
2-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenoxy]methyl]oxirane (PubChem CID 91501744) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 91501744 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[[4-(2-methylpropyl)-3-(trifluoromethyl)phenoxy]methyl]oxirane |
| SMILES | CC(C)Cc1ccc(OCC2CO2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3O2/c1-9(2)5-10-3-4-11(18-7-12-8-19-12)6-13(10)14(15,16)17/h3-4,6,9,12H,5,7-8H2,1-2H3 |
| InChIKey | DHOOOZYWNCCFEF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|