C32H30F8O6 — CID 59791148
2-[[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]methyl]oxirane (PubChem CID 59791148) has the molecular formula C32H30F8O6 and a molecular weight of 662.57 g/mol. Its IUPAC name is 2-[[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 59791148 |
| Molecular Formula | C32H30F8O6 |
| Molecular Weight | 662.57 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | 2-[[3-fluoro-4-[3-[4-[3-[2-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propoxy]-2,3-bis(trifluoromethyl)phenoxy]propyl]phenoxy]methyl]oxirane |
| SMILES | Fc1cc(OCC2CO2)ccc1CCCOc1ccc(OCCCc2ccc(OCC3CO3)cc2F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C32H30F8O6/c33-25-13-21(43-15-23-17-45-23)7-5-19(25)3-1-11-41-27-9-10-28(30(32(38,39)40)29(27)31(35,36)37)42-12-2-4-20-6-8-22(14-26(20)34)44-16-24-18-46-24/h5-10,13-14,23-24H,1-4,11-12,15-18H2 |
| InChIKey | YQUPHTPQLHSJQC-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.57 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|