C13H12O2 — CID 726163
(2S)-2-(naphthalen-2-yloxymethyl)oxirane (PubChem CID 726163) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (2S)-2-(naphthalen-2-yloxymethyl)oxirane.
| Compound Name | (2S)-2-(naphthalen-2-yloxymethyl)oxirane |
|---|---|
| PubChem CID | 726163 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2S)-2-(naphthalen-2-yloxymethyl)oxirane |
| SMILES | c1ccc2cc(OC[C@@H]3CO3)ccc2c1 |
| InChI | InChI=1S/C13H12O2/c1-2-4-11-7-12(6-5-10(11)3-1)14-8-13-9-15-13/h1-7,13H,8-9H2/t13-/m1/s1 |
| InChIKey | BKYSFVJCBRHGMA-CYBMUJFWSA-N |
| XLogP | 2.62 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|