C26H24O6 — CID 167603505
naphthalene-2,6-diol;2-[[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxymethyl]oxirane (PubChem CID 167603505) has the molecular formula C26H24O6 and a molecular weight of 432.47 g/mol. Its IUPAC name is naphthalene-2,6-diol;2-[[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxymethyl]oxirane.
| Compound Name | naphthalene-2,6-diol;2-[[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 167603505 |
| Molecular Formula | C26H24O6 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | naphthalene-2,6-diol;2-[[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxymethyl]oxirane |
| SMILES | Oc1ccc2cc(O)ccc2c1.c1cc2cc(OCC3CO3)ccc2cc1OCC1CO1 |
| InChI | InChI=1S/C16H16O4.C10H8O2/c1-3-13(17-7-15-9-19-15)6-12-2-4-14(5-11(1)12)18-8-16-10-20-16;11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6,15-16H,7-10H2;1-6,11-12H |
| InChIKey | KBHGGWOWRRLBOR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|