C30H27N3O9 — CID 147213170
2-[4,6-bis[2-hydroxy-4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazin-2-yl]-5-(oxiran-2-ylmethoxy)phenol (PubChem CID 147213170) has the molecular formula C30H27N3O9 and a molecular weight of 573.56 g/mol. Its IUPAC name is 2-[4,6-bis[2-hydroxy-4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazin-2-yl]-5-(oxiran-2-ylmethoxy)phenol.
| Compound Name | 2-[4,6-bis[2-hydroxy-4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazin-2-yl]-5-(oxiran-2-ylmethoxy)phenol |
|---|---|
| PubChem CID | 147213170 |
| Molecular Formula | C30H27N3O9 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 2-[4,6-bis[2-hydroxy-4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazin-2-yl]-5-(oxiran-2-ylmethoxy)phenol |
| SMILES | Oc1cc(OCC2CO2)ccc1-c1nc(-c2ccc(OCC3CO3)cc2O)nc(-c2ccc(OCC3CO3)cc2O)n1 |
| InChI | InChI=1S/C30H27N3O9/c34-25-7-16(37-10-19-13-40-19)1-4-22(25)28-31-29(23-5-2-17(8-26(23)35)38-11-20-14-41-20)33-30(32-28)24-6-3-18(9-27(24)36)39-12-21-15-42-21/h1-9,19-21,34-36H,10-15H2 |
| InChIKey | CFPCJGZGUDQOHT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|