C17H14N2O3 — CID 142978717
2-[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxypyrimidine (PubChem CID 142978717) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxypyrimidine.
| Compound Name | 2-[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxypyrimidine |
|---|---|
| PubChem CID | 142978717 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[6-(oxiran-2-ylmethoxy)naphthalen-2-yl]oxypyrimidine |
| SMILES | c1cnc(Oc2ccc3cc(OCC4CO4)ccc3c2)nc1 |
| InChI | InChI=1S/C17H14N2O3/c1-6-18-17(19-7-1)22-15-5-3-12-8-14(4-2-13(12)9-15)20-10-16-11-21-16/h1-9,16H,10-11H2 |
| InChIKey | CLNLLGVFOXYSAJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 56.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|