C11H9O5+ — CID 174669701
hydron;5-(oxiran-2-ylmethoxy)-2-benzofuran-1,3-dione (PubChem CID 174669701) has the molecular formula C11H9O5+ and a molecular weight of 221.19 g/mol. Its IUPAC name is hydron;5-(oxiran-2-ylmethoxy)-2-benzofuran-1,3-dione.
| Compound Name | hydron;5-(oxiran-2-ylmethoxy)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174669701 |
| Molecular Formula | C11H9O5+ |
| Molecular Weight | 221.19 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | hydron;5-(oxiran-2-ylmethoxy)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(OCC3CO3)ccc21.[H+] |
| InChI | InChI=1S/C11H8O5/c12-10-8-2-1-6(14-4-7-5-15-7)3-9(8)11(13)16-10/h1-3,7H,4-5H2/p+1 |
| InChIKey | RIAUSLTUSBPZFS-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|