C23H21NO8 — CID 139773404
2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-5-(oxiran-2-ylmethoxy)isoindole-1,3-dione (PubChem CID 139773404) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is 2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-5-(oxiran-2-ylmethoxy)isoindole-1,3-dione.
| Compound Name | 2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-5-(oxiran-2-ylmethoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 139773404 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[3,5-bis(oxiran-2-ylmethoxy)phenyl]-5-(oxiran-2-ylmethoxy)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(OCC3CO3)cc2C(=O)N1c1cc(OCC2CO2)cc(OCC2CO2)c1 |
| InChI | InChI=1S/C23H21NO8/c25-22-20-2-1-14(27-7-17-10-30-17)6-21(20)23(26)24(22)13-3-15(28-8-18-11-31-18)5-16(4-13)29-9-19-12-32-19/h1-6,17-19H,7-12H2 |
| InChIKey | TWJMEMGRJDHOJP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|