C30H27N3O9 — CID 88596302
1,3,5-tris[4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 88596302) has the molecular formula C30H27N3O9 and a molecular weight of 573.56 g/mol. Its IUPAC name is 1,3,5-tris[4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 88596302 |
| Molecular Formula | C30H27N3O9 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | 1,3,5-tris[4-(oxiran-2-ylmethoxy)phenyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n(-c2ccc(OCC3CO3)cc2)c(=O)n(-c2ccc(OCC3CO3)cc2)c(=O)n1-c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C30H27N3O9/c34-28-31(19-1-7-22(8-2-19)37-13-25-16-40-25)29(35)33(21-5-11-24(12-6-21)39-15-27-18-42-27)30(36)32(28)20-3-9-23(10-4-20)38-14-26-17-41-26/h1-12,25-27H,13-18H2 |
| InChIKey | LNASIRSFKDSTDY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 131.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|