C20H17NO6 — CID 139773375
5-(oxiran-2-ylmethoxy)-2-[2-(oxiran-2-ylmethoxy)phenyl]isoindole-1,3-dione (PubChem CID 139773375) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-(oxiran-2-ylmethoxy)-2-[2-(oxiran-2-ylmethoxy)phenyl]isoindole-1,3-dione.
| Compound Name | 5-(oxiran-2-ylmethoxy)-2-[2-(oxiran-2-ylmethoxy)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139773375 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-(oxiran-2-ylmethoxy)-2-[2-(oxiran-2-ylmethoxy)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(OCC3CO3)cc2C(=O)N1c1ccccc1OCC1CO1 |
| InChI | InChI=1S/C20H17NO6/c22-19-15-6-5-12(24-8-13-9-25-13)7-16(15)20(23)21(19)17-3-1-2-4-18(17)27-11-14-10-26-14/h1-7,13-14H,8-11H2 |
| InChIKey | LAQCYXJPQLRRKA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|