C28H27NO5 — CID 135215512
1-methyl-2-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-2-[4-(oxiran-2-ylmethoxy)phenyl]indol-3-one (PubChem CID 135215512) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-methyl-2-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-2-[4-(oxiran-2-ylmethoxy)phenyl]indol-3-one.
| Compound Name | 1-methyl-2-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-2-[4-(oxiran-2-ylmethoxy)phenyl]indol-3-one |
|---|---|
| PubChem CID | 135215512 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 1-methyl-2-[3-methyl-4-(oxiran-2-ylmethoxy)phenyl]-2-[4-(oxiran-2-ylmethoxy)phenyl]indol-3-one |
| SMILES | Cc1cc(C2(c3ccc(OCC4CO4)cc3)C(=O)c3ccccc3N2C)ccc1OCC1CO1 |
| InChI | InChI=1S/C28H27NO5/c1-18-13-20(9-12-26(18)34-17-23-16-33-23)28(27(30)24-5-3-4-6-25(24)29(28)2)19-7-10-21(11-8-19)31-14-22-15-32-22/h3-13,22-23H,14-17H2,1-2H3 |
| InChIKey | SXGWXQPXAWQZOL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|