C28H30ClNO5 — CID 135215519
2-[4-(3-chloro-2-hydroxypropoxy)phenyl]-1-methyl-2-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]indol-3-one (PubChem CID 135215519) has the molecular formula C28H30ClNO5 and a molecular weight of 496.00 g/mol. Its IUPAC name is 2-[4-(3-chloro-2-hydroxypropoxy)phenyl]-1-methyl-2-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]indol-3-one.
| Compound Name | 2-[4-(3-chloro-2-hydroxypropoxy)phenyl]-1-methyl-2-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]indol-3-one |
|---|---|
| PubChem CID | 135215519 |
| Molecular Formula | C28H30ClNO5 |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[4-(3-chloro-2-hydroxypropoxy)phenyl]-1-methyl-2-[(2E,4Z)-6-(oxiran-2-ylmethoxy)hepta-2,4,6-trien-3-yl]indol-3-one |
| SMILES | C=C(/C=C\C(=C/C)C1(c2ccc(OCC(O)CCl)cc2)C(=O)c2ccccc2N1C)OCC1CO1 |
| InChI | InChI=1S/C28H30ClNO5/c1-4-20(10-9-19(2)33-17-24-18-35-24)28(27(32)25-7-5-6-8-26(25)30(28)3)21-11-13-23(14-12-21)34-16-22(31)15-29/h4-14,22,24,31H,2,15-18H2,1,3H3/b10-9-,20-4+ |
| InChIKey | CBRWRTWJZLCPBZ-GRFYROJPSA-N |
| XLogP | 4.62 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|