C31H27ClO4 — CID 89157873
1-chloro-3-[4-[9-[4-[[(2R)-oxiran-2-yl]methoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-ol (PubChem CID 89157873) has the molecular formula C31H27ClO4 and a molecular weight of 499.01 g/mol. Its IUPAC name is 1-chloro-3-[4-[9-[4-[[(2R)-oxiran-2-yl]methoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-ol.
| Compound Name | 1-chloro-3-[4-[9-[4-[[(2R)-oxiran-2-yl]methoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 89157873 |
| Molecular Formula | C31H27ClO4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1-chloro-3-[4-[9-[4-[[(2R)-oxiran-2-yl]methoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-ol |
| SMILES | OC(CCl)COc1ccc(C2(c3ccc(OC[C@H]4CO4)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C31H27ClO4/c32-17-23(33)18-34-24-13-9-21(10-14-24)31(22-11-15-25(16-12-22)35-19-26-20-36-26)29-7-3-1-5-27(29)28-6-2-4-8-30(28)31/h1-16,23,26,33H,17-20H2/t23?,26-/m0/s1 |
| InChIKey | MICOADQKZQRAMI-NASUQTAISA-N |
| XLogP | 5.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|