C33H34O4 — CID 139725546
1-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]butan-2-ol (PubChem CID 139725546) has the molecular formula C33H34O4 and a molecular weight of 494.63 g/mol. Its IUPAC name is 1-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]butan-2-ol.
| Compound Name | 1-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 139725546 |
| Molecular Formula | C33H34O4 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | 1-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(C2(c3ccc(OCC(O)CC)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C33H34O4/c1-3-25(34)21-36-27-17-13-23(14-18-27)33(24-15-19-28(20-16-24)37-22-26(35)4-2)31-11-7-5-9-29(31)30-10-6-8-12-32(30)33/h5-20,25-26,34-35H,3-4,21-22H2,1-2H3 |
| InChIKey | FSSZNPNGMUMPQM-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |