C36H40O5 — CID 159370670
3-[4-[9-[4-(3-butoxy-2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]-2-methylpropan-1-ol (PubChem CID 159370670) has the molecular formula C36H40O5 and a molecular weight of 552.71 g/mol. Its IUPAC name is 3-[4-[9-[4-(3-butoxy-2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]-2-methylpropan-1-ol.
| Compound Name | 3-[4-[9-[4-(3-butoxy-2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 159370670 |
| Molecular Formula | C36H40O5 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 3-[4-[9-[4-(3-butoxy-2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]-2-methylpropan-1-ol |
| SMILES | CCCCOCC(O)COc1ccc(C2(c3ccc(OCC(C)CO)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C36H40O5/c1-3-4-21-39-24-29(38)25-41-31-19-15-28(16-20-31)36(27-13-17-30(18-14-27)40-23-26(2)22-37)34-11-7-5-9-32(34)33-10-6-8-12-35(33)36/h5-20,26,29,37-38H,3-4,21-25H2,1-2H3 |
| InChIKey | XIPMHLWHWCTNJE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|