C33H30O8Y-2 — CID 59270983
[2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]methanone;hydroxymethanone;yttrium (PubChem CID 59270983) has the molecular formula C33H30O8Y-2 and a molecular weight of 643.50 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]methanone;hydroxymethanone;yttrium.
| Compound Name | [2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]methanone;hydroxymethanone;yttrium |
|---|---|
| PubChem CID | 59270983 |
| Molecular Formula | C33H30O8Y-2 |
| Molecular Weight | 643.50 g/mol |
| Exact Mass | 643.10 |
| IUPAC Name | [2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]methanone;hydroxymethanone;yttrium |
| SMILES | CC(O)COc1ccc(C2(c3ccc(OCC(O)CO[C-]=O)cc3)c3ccccc3-c3ccccc32)cc1.O=[C-]O.[Y] |
| InChI | InChI=1S/C32H29O6.CHO2.Y/c1-22(34)18-37-26-14-10-23(11-15-26)32(24-12-16-27(17-13-24)38-20-25(35)19-36-21-33)30-8-4-2-6-28(30)29-7-3-5-9-31(29)32;2-1-3;/h2-17,22,25,34-35H,18-20H2,1H3;(H,2,3);/q2*-1; |
| InChIKey | WMIPMDZOCXGXGH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|