C39H38O8 — CID 59270985
6-[2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]carbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 59270985) has the molecular formula C39H38O8 and a molecular weight of 634.72 g/mol. Its IUPAC name is 6-[2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]carbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 59270985 |
| Molecular Formula | C39H38O8 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 6-[2-hydroxy-3-[4-[9-[4-(2-hydroxypropoxy)phenyl]fluoren-9-yl]phenoxy]propoxy]carbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC(O)COc1ccc(C2(c3ccc(OCC(O)COC(=O)C4CC=CCC4C(=O)O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C39H38O8/c1-25(40)22-45-29-18-14-26(15-19-29)39(35-12-6-4-8-31(35)32-9-5-7-13-36(32)39)27-16-20-30(21-17-27)46-23-28(41)24-47-38(44)34-11-3-2-10-33(34)37(42)43/h2-9,12-21,25,28,33-34,40-41H,10-11,22-24H2,1H3,(H,42,43) |
| InChIKey | ZVUUMZCRXIPMKX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|