C48H51NO10 — CID 153420074
[3-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 6-propanoylcyclohex-3-ene-1-carboxylate (PubChem CID 153420074) has the molecular formula C48H51NO10 and a molecular weight of 801.93 g/mol. Its IUPAC name is [3-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 6-propanoylcyclohex-3-ene-1-carboxylate.
| Compound Name | [3-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 6-propanoylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 153420074 |
| Molecular Formula | C48H51NO10 |
| Molecular Weight | 801.93 g/mol |
| Exact Mass | 801.35 |
| IUPAC Name | [3-[4-[9-[4-(2-hydroxybutoxy)phenyl]fluoren-9-yl]phenoxy]-2-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl] 6-propanoylcyclohex-3-ene-1-carboxylate |
| SMILES | C=CC(=O)OCCNC(=O)OC(COC(=O)C1CC=CCC1C(=O)CC)COc1ccc(C2(c3ccc(OCC(O)CC)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C48H51NO10/c1-4-34(50)29-56-35-23-19-32(20-24-35)48(42-17-11-9-13-38(42)39-14-10-12-18-43(39)48)33-21-25-36(26-22-33)57-30-37(59-47(54)49-27-28-55-45(52)6-3)31-58-46(53)41-16-8-7-15-40(41)44(51)5-2/h6-14,17-26,34,37,40-41,50H,3-5,15-16,27-31H2,1-2H3,(H,49,54) |
| InChIKey | DAEXKKPPVBVCEE-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.93 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|