C39H38O8 — CID 59702760
2-[2-[4-[9-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 59702760) has the molecular formula C39H38O8 and a molecular weight of 634.72 g/mol. Its IUPAC name is 2-[2-[4-[9-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-[9-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 59702760 |
| Molecular Formula | C39H38O8 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | 2-[2-[4-[9-[4-[2-(2-prop-2-enoyloxyethoxy)ethoxy]phenyl]fluoren-9-yl]phenoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1ccc(C2(c3ccc(OCCOCCOC(=O)C=C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C39H38O8/c1-3-37(40)46-27-23-42-21-25-44-31-17-13-29(14-18-31)39(35-11-7-5-9-33(35)34-10-6-8-12-36(34)39)30-15-19-32(20-16-30)45-26-22-43-24-28-47-38(41)4-2/h3-20H,1-2,21-28H2 |
| InChIKey | VVGOWZGWXIUYFK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|