C45H50O6 — CID 168867072
6-[4-[9-[4-(6-but-2-enoyloxyhexoxy)phenyl]fluoren-9-yl]phenoxy]hexyl but-2-enoate (PubChem CID 168867072) has the molecular formula C45H50O6 and a molecular weight of 686.89 g/mol. Its IUPAC name is 6-[4-[9-[4-(6-but-2-enoyloxyhexoxy)phenyl]fluoren-9-yl]phenoxy]hexyl but-2-enoate.
| Compound Name | 6-[4-[9-[4-(6-but-2-enoyloxyhexoxy)phenyl]fluoren-9-yl]phenoxy]hexyl but-2-enoate |
|---|---|
| PubChem CID | 168867072 |
| Molecular Formula | C45H50O6 |
| Molecular Weight | 686.89 g/mol |
| Exact Mass | 686.36 |
| IUPAC Name | 6-[4-[9-[4-(6-but-2-enoyloxyhexoxy)phenyl]fluoren-9-yl]phenoxy]hexyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCCCCOc1ccc(C2(c3ccc(OCCCCCCOC(=O)C=CC)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C45H50O6/c1-3-17-43(46)50-33-15-7-5-13-31-48-37-27-23-35(24-28-37)45(41-21-11-9-19-39(41)40-20-10-12-22-42(40)45)36-25-29-38(30-26-36)49-32-14-6-8-16-34-51-44(47)18-4-2/h3-4,9-12,17-30H,5-8,13-16,31-34H2,1-2H3 |
| InChIKey | XYKROOKQFHXZBL-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.89 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|