C37H34O6 — CID 100914057
prop-2-enyl 3-[4-[9-[4-(3-oxo-3-prop-2-enoxypropoxy)phenyl]fluoren-9-yl]phenoxy]propanoate (PubChem CID 100914057) has the molecular formula C37H34O6 and a molecular weight of 574.67 g/mol. Its IUPAC name is prop-2-enyl 3-[4-[9-[4-(3-oxo-3-prop-2-enoxypropoxy)phenyl]fluoren-9-yl]phenoxy]propanoate.
| Compound Name | prop-2-enyl 3-[4-[9-[4-(3-oxo-3-prop-2-enoxypropoxy)phenyl]fluoren-9-yl]phenoxy]propanoate |
|---|---|
| PubChem CID | 100914057 |
| Molecular Formula | C37H34O6 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | prop-2-enyl 3-[4-[9-[4-(3-oxo-3-prop-2-enoxypropoxy)phenyl]fluoren-9-yl]phenoxy]propanoate |
| SMILES | C=CCOC(=O)CCOc1ccc(C2(c3ccc(OCCC(=O)OCC=C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H34O6/c1-3-23-42-35(38)21-25-40-29-17-13-27(14-18-29)37(33-11-7-5-9-31(33)32-10-6-8-12-34(32)37)28-15-19-30(20-16-28)41-26-22-36(39)43-24-4-2/h3-20H,1-2,21-26H2 |
| InChIKey | JFUJOPMWYHOLDE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|