C37H34O8 — CID 98048093
[(2S)-2-hydroxy-3-[4-[9-[4-[(2S)-2-hydroxy-3-prop-2-enoyloxypropoxy]phenyl]fluoren-9-yl]phenoxy]propyl] prop-2-enoate (PubChem CID 98048093) has the molecular formula C37H34O8 and a molecular weight of 606.67 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[4-[9-[4-[(2S)-2-hydroxy-3-prop-2-enoyloxypropoxy]phenyl]fluoren-9-yl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [(2S)-2-hydroxy-3-[4-[9-[4-[(2S)-2-hydroxy-3-prop-2-enoyloxypropoxy]phenyl]fluoren-9-yl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 98048093 |
| Molecular Formula | C37H34O8 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-[4-[9-[4-[(2S)-2-hydroxy-3-prop-2-enoyloxypropoxy]phenyl]fluoren-9-yl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H](O)COc1ccc(C2(c3ccc(OC[C@H](O)COC(=O)C=C)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H34O8/c1-3-35(40)44-23-27(38)21-42-29-17-13-25(14-18-29)37(33-11-7-5-9-31(33)32-10-6-8-12-34(32)37)26-15-19-30(20-16-26)43-22-28(39)24-45-36(41)4-2/h3-20,27-28,38-39H,1-2,21-24H2/t27-,28-/m0/s1 |
| InChIKey | VUGKXJFTPZXBTJ-NSOVKSMOSA-N |
| XLogP | 4.99 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|