C43H38O10 — CID 118227625
[3-[4-[9-[4-[1,2-di(prop-2-enoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 118227625) has the molecular formula C43H38O10 and a molecular weight of 714.77 g/mol. Its IUPAC name is [3-[4-[9-[4-[1,2-di(prop-2-enoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [3-[4-[9-[4-[1,2-di(prop-2-enoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 118227625 |
| Molecular Formula | C43H38O10 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.25 |
| IUPAC Name | [3-[4-[9-[4-[1,2-di(prop-2-enoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]-2-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COc1ccc(C2(c3ccc(OC(OC(=O)C=C)C(C)OC(=O)C=C)cc3)c3ccccc3-c3ccccc32)cc1)OC(=O)C=C |
| InChI | InChI=1S/C43H38O10/c1-6-38(44)49-27-33(51-40(46)8-3)26-48-31-22-18-29(19-23-31)43(36-16-12-10-14-34(36)35-15-11-13-17-37(35)43)30-20-24-32(25-21-30)52-42(53-41(47)9-4)28(5)50-39(45)7-2/h6-25,28,33,42H,1-4,26-27H2,5H3 |
| InChIKey | MSTYAPZNHGJCGH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|