C57H54O10S2 — CID 159166043
[1-phenylsulfanyl-3-[4-[9-[4-[3-phenylsulfanyl-2-(4-prop-2-enoyloxybutanoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-yl] 4-prop-2-enoyloxybutanoate (PubChem CID 159166043) has the molecular formula C57H54O10S2 and a molecular weight of 963.18 g/mol. Its IUPAC name is [1-phenylsulfanyl-3-[4-[9-[4-[3-phenylsulfanyl-2-(4-prop-2-enoyloxybutanoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-yl] 4-prop-2-enoyloxybutanoate.
| Compound Name | [1-phenylsulfanyl-3-[4-[9-[4-[3-phenylsulfanyl-2-(4-prop-2-enoyloxybutanoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-yl] 4-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 159166043 |
| Molecular Formula | C57H54O10S2 |
| Molecular Weight | 963.18 g/mol |
| Exact Mass | 962.32 |
| IUPAC Name | [1-phenylsulfanyl-3-[4-[9-[4-[3-phenylsulfanyl-2-(4-prop-2-enoyloxybutanoyloxy)propoxy]phenyl]fluoren-9-yl]phenoxy]propan-2-yl] 4-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)OCCCC(=O)OC(COc1ccc(C2(c3ccc(OCC(CSc4ccccc4)OC(=O)CCCOC(=O)C=C)cc3)c3ccccc3-c3ccccc32)cc1)CSc1ccccc1 |
| InChI | InChI=1S/C57H54O10S2/c1-3-53(58)62-35-15-25-55(60)66-45(39-68-47-17-7-5-8-18-47)37-64-43-31-27-41(28-32-43)57(51-23-13-11-21-49(51)50-22-12-14-24-52(50)57)42-29-33-44(34-30-42)65-38-46(40-69-48-19-9-6-10-20-48)67-56(61)26-16-36-63-54(59)4-2/h3-14,17-24,27-34,45-46H,1-2,15-16,25-26,35-40H2 |
| InChIKey | KLBVERIEIJTDNX-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.18 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|