C22H32O7 — CID 159786744
[1-(4-ethoxybutoxy)-3-phenoxypropan-2-yl] 4-prop-2-enoyloxybutanoate (PubChem CID 159786744) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [1-(4-ethoxybutoxy)-3-phenoxypropan-2-yl] 4-prop-2-enoyloxybutanoate.
| Compound Name | [1-(4-ethoxybutoxy)-3-phenoxypropan-2-yl] 4-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 159786744 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [1-(4-ethoxybutoxy)-3-phenoxypropan-2-yl] 4-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)OCCCC(=O)OC(COCCCCOCC)COc1ccccc1 |
| InChI | InChI=1S/C22H32O7/c1-3-21(23)27-16-10-13-22(24)29-20(17-26-15-9-8-14-25-4-2)18-28-19-11-6-5-7-12-19/h3,5-7,11-12,20H,1,4,8-10,13-18H2,2H3 |
| InChIKey | NKSZVVBTBLMOKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|