C20H26O7 — CID 145123352
4-[3-(4-methoxyphenoxy)-2-prop-2-enoyloxypropoxy]butyl prop-2-enoate (PubChem CID 145123352) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenoxy)-2-prop-2-enoyloxypropoxy]butyl prop-2-enoate.
| Compound Name | 4-[3-(4-methoxyphenoxy)-2-prop-2-enoyloxypropoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 145123352 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 4-[3-(4-methoxyphenoxy)-2-prop-2-enoyloxypropoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(OC)cc1)OC(=O)C=C |
| InChI | InChI=1S/C20H26O7/c1-4-19(21)25-13-7-6-12-24-14-18(27-20(22)5-2)15-26-17-10-8-16(23-3)9-11-17/h4-5,8-11,18H,1-2,6-7,12-15H2,3H3 |
| InChIKey | SQRZTCSXRXEJBF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|