C37H35NO12 — CID 145317820
[2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate (PubChem CID 145317820) has the molecular formula C37H35NO12 and a molecular weight of 685.68 g/mol. Its IUPAC name is [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate.
| Compound Name | [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
|---|---|
| PubChem CID | 145317820 |
| Molecular Formula | C37H35NO12 |
| Molecular Weight | 685.68 g/mol |
| Exact Mass | 685.22 |
| IUPAC Name | [2-methanimidoyl-4-(4-prop-2-enoyloxybenzoyl)oxyphenyl] 4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoate |
| SMILES | [H]/N=C/c1cc(OC(=O)c2ccc(OC(=O)C=C)cc2)ccc1OC(=O)c1ccc(OCC(COCCCCOC(=O)C=C)OC(=O)C=C)cc1 |
| InChI | InChI=1S/C37H35NO12/c1-4-33(39)45-20-8-7-19-44-23-31(48-35(41)6-3)24-46-28-13-9-26(10-14-28)37(43)50-32-18-17-30(21-27(32)22-38)49-36(42)25-11-15-29(16-12-25)47-34(40)5-2/h4-6,9-18,21-22,31,38H,1-3,7-8,19-20,23-24H2/b38-22+ |
| InChIKey | ZGMBRMVMEJWZMX-NNLKUIAGSA-N |
| XLogP | 5.22 |
| TPSA | 173.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|