C26H31NO6 — CID 145093741
[2-methanimidoyl-4-(2-methoxyethyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 145093741) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is [2-methanimidoyl-4-(2-methoxyethyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [2-methanimidoyl-4-(2-methoxyethyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 145093741 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | [2-methanimidoyl-4-(2-methoxyethyl)phenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | [H]/N=C/c1cc(CCOC)ccc1OC(=O)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C26H31NO6/c1-3-25(28)32-16-7-5-4-6-15-31-23-11-9-21(10-12-23)26(29)33-24-13-8-20(14-17-30-2)18-22(24)19-27/h3,8-13,18-19,27H,1,4-7,14-17H2,2H3/b27-19+ |
| InChIKey | LUFWTQIWEPDZJQ-ZXVVBBHZSA-N |
| XLogP | 4.76 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|