C30H37NO5 — CID 142364145
6-[4-[cyclobutylidene-[2-methanimidoyl-4-(2-methoxyethyl)phenoxy]methyl]phenoxy]hexyl prop-2-enoate (PubChem CID 142364145) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is 6-[4-[cyclobutylidene-[2-methanimidoyl-4-(2-methoxyethyl)phenoxy]methyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[cyclobutylidene-[2-methanimidoyl-4-(2-methoxyethyl)phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 142364145 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 6-[4-[cyclobutylidene-[2-methanimidoyl-4-(2-methoxyethyl)phenoxy]methyl]phenoxy]hexyl prop-2-enoate |
| SMILES | [H]/N=C/c1cc(CCOC)ccc1OC(=C1CCC1)c1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C30H37NO5/c1-3-29(32)35-19-7-5-4-6-18-34-27-14-12-25(13-15-27)30(24-9-8-10-24)36-28-16-11-23(17-20-33-2)21-26(28)22-31/h3,11-16,21-22,31H,1,4-10,17-20H2,2H3/b31-22+ |
| InChIKey | BVDQDEFLNUCDLE-DFKUXCBWSA-N |
| XLogP | 6.52 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|