C39H44N2O7 — CID 167166410
[2-methanimidoyl-4-(3-methanimidoyl-4-methoxyphenyl)phenyl] 4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]acetyl]cyclohexane-1-carboxylate (PubChem CID 167166410) has the molecular formula C39H44N2O7 and a molecular weight of 652.79 g/mol. Its IUPAC name is [2-methanimidoyl-4-(3-methanimidoyl-4-methoxyphenyl)phenyl] 4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]acetyl]cyclohexane-1-carboxylate.
| Compound Name | [2-methanimidoyl-4-(3-methanimidoyl-4-methoxyphenyl)phenyl] 4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]acetyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167166410 |
| Molecular Formula | C39H44N2O7 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.31 |
| IUPAC Name | [2-methanimidoyl-4-(3-methanimidoyl-4-methoxyphenyl)phenyl] 4-[2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]acetyl]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C/c1cc(-c2ccc(OC(=O)C3CCC(C(=O)Cc4ccc(OCCCCCCOC(=O)C=C)cc4)CC3)c(/C=N/[H])c2)ccc1OC |
| InChI | InChI=1S/C39H44N2O7/c1-3-38(43)47-21-7-5-4-6-20-46-34-16-8-27(9-17-34)22-35(42)28-10-12-29(13-11-28)39(44)48-37-19-15-31(24-33(37)26-41)30-14-18-36(45-2)32(23-30)25-40/h3,8-9,14-19,23-26,28-29,40-41H,1,4-7,10-13,20-22H2,2H3/b40-25+,41-26+ |
| InChIKey | NEYSHTHNYVRVCL-QHTJZBTGSA-N |
| XLogP | 7.55 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|