C33H43NO10 — CID 130417233
[3-methanimidoyl-4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate (PubChem CID 130417233) has the molecular formula C33H43NO10 and a molecular weight of 613.70 g/mol. Its IUPAC name is [3-methanimidoyl-4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate.
| Compound Name | [3-methanimidoyl-4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 130417233 |
| Molecular Formula | C33H43NO10 |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | [3-methanimidoyl-4-[4-(3-prop-2-enoyloxypropoxy)cyclohexanecarbonyl]oxyphenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate |
| SMILES | [H]/N=C/c1cc(OC(=O)C2CCC(OCCCOC(=O)C=C)CC2)ccc1OC(=O)C1CCC(OCCCOC(=O)C=C)CC1 |
| InChI | InChI=1S/C33H43NO10/c1-3-30(35)41-19-5-17-39-26-11-7-23(8-12-26)32(37)43-28-15-16-29(25(21-28)22-34)44-33(38)24-9-13-27(14-10-24)40-18-6-20-42-31(36)4-2/h3-4,15-16,21-24,26-27,34H,1-2,5-14,17-20H2/b34-22+ |
| InChIKey | HTSXLIHXNFPHGT-PPOKSSTKSA-N |
| XLogP | 4.88 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|