C38H55NO10 — CID 145493654
[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)piperidine-1-carboxylate (PubChem CID 145493654) has the molecular formula C38H55NO10 and a molecular weight of 685.86 g/mol. Its IUPAC name is [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)piperidine-1-carboxylate.
| Compound Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 145493654 |
| Molecular Formula | C38H55NO10 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)piperidine-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(C(=O)Oc2ccc(OC(=O)N3CCC(OCCCCCCOC(=O)C=C)CC3)cc2C)CC1 |
| InChI | InChI=1S/C38H55NO10/c1-4-35(40)46-26-12-8-6-10-24-44-31-16-14-30(15-17-31)37(42)49-34-19-18-33(28-29(34)3)48-38(43)39-22-20-32(21-23-39)45-25-11-7-9-13-27-47-36(41)5-2/h4-5,18-19,28,30-32H,1-2,6-17,20-27H2,3H3 |
| InChIKey | HUBPPRWPZSYHNU-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|