C30H36O8 — CID 153066208
[4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate (PubChem CID 153066208) has the molecular formula C30H36O8 and a molecular weight of 524.61 g/mol. Its IUPAC name is [4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 153066208 |
| Molecular Formula | C30H36O8 |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | [4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-methoxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(C(=O)Oc2ccc(OC(=O)c3ccc(OC)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H36O8/c1-3-28(31)36-21-7-5-4-6-20-35-25-14-10-23(11-15-25)30(33)38-27-18-16-26(17-19-27)37-29(32)22-8-12-24(34-2)13-9-22/h3,8-9,12-13,16-19,23,25H,1,4-7,10-11,14-15,20-21H2,2H3 |
| InChIKey | VKKVVGPUZBHSDT-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|