C36H50O8 — CID 142363253
[(3Z)-5-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyhexa-1,3,5-trien-2-yl] 4-heptoxybenzoate (PubChem CID 142363253) has the molecular formula C36H50O8 and a molecular weight of 610.79 g/mol. Its IUPAC name is [(3Z)-5-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyhexa-1,3,5-trien-2-yl] 4-heptoxybenzoate.
| Compound Name | [(3Z)-5-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyhexa-1,3,5-trien-2-yl] 4-heptoxybenzoate |
|---|---|
| PubChem CID | 142363253 |
| Molecular Formula | C36H50O8 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | [(3Z)-5-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyhexa-1,3,5-trien-2-yl] 4-heptoxybenzoate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(C(=O)OC(=C)/C=C\C(=C)OC(=O)c2ccc(OCCCCCCC)cc2)CC1 |
| InChI | InChI=1S/C36H50O8/c1-5-7-8-9-12-25-40-32-21-17-30(18-22-32)35(38)43-28(3)15-16-29(4)44-36(39)31-19-23-33(24-20-31)41-26-13-10-11-14-27-42-34(37)6-2/h6,15-18,21-22,31,33H,2-5,7-14,19-20,23-27H2,1H3/b16-15- |
| InChIKey | NDEVHJZPUAWQLK-NXVVXOECSA-N |
| XLogP | 8.18 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|