C34H40O11 — CID 122417154
1-O-(4-methoxyphenyl) 4-O-[4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 122417154) has the molecular formula C34H40O11 and a molecular weight of 624.68 g/mol. Its IUPAC name is 1-O-(4-methoxyphenyl) 4-O-[4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(4-methoxyphenyl) 4-O-[4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 122417154 |
| Molecular Formula | C34H40O11 |
| Molecular Weight | 624.68 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 1-O-(4-methoxyphenyl) 4-O-[4-[2-prop-2-enoyloxy-3-(4-prop-2-enoyloxybutoxy)propoxy]phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC)cc3)CC2)cc1)OC(=O)C=C |
| InChI | InChI=1S/C34H40O11/c1-4-31(35)41-21-7-6-20-40-22-30(43-32(36)5-2)23-42-27-14-18-29(19-15-27)45-34(38)25-10-8-24(9-11-25)33(37)44-28-16-12-26(39-3)13-17-28/h4-5,12-19,24-25,30H,1-2,6-11,20-23H2,3H3 |
| InChIKey | AKVYYXSGIYZKII-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|