C40H60O9 — CID 134412896
[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-but-3-en-2-yloxyhexoxy)cyclohexane-1-carboxylate (PubChem CID 134412896) has the molecular formula C40H60O9 and a molecular weight of 684.91 g/mol. Its IUPAC name is [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-but-3-en-2-yloxyhexoxy)cyclohexane-1-carboxylate.
| Compound Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-but-3-en-2-yloxyhexoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134412896 |
| Molecular Formula | C40H60O9 |
| Molecular Weight | 684.91 g/mol |
| Exact Mass | 684.42 |
| IUPAC Name | [3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)cyclohexanecarbonyl]oxyphenyl] 4-(6-but-3-en-2-yloxyhexoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(OCCCCCCOC(C)C=C)CC3)cc2C)CC1 |
| InChI | InChI=1S/C40H60O9/c1-5-31(4)44-25-11-7-8-12-26-45-34-19-15-32(16-20-34)39(42)48-36-23-24-37(30(3)29-36)49-40(43)33-17-21-35(22-18-33)46-27-13-9-10-14-28-47-38(41)6-2/h5-6,23-24,29,31-35H,1-2,7-22,25-28H2,3-4H3 |
| InChIKey | NBZIUQWTEWQLFH-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.91 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|