C30H31ClO9 — CID 23529939
4-O-[2-chloro-4-(4-prop-2-enoyloxybutoxy)phenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate (PubChem CID 23529939) has the molecular formula C30H31ClO9 and a molecular weight of 571.02 g/mol. Its IUPAC name is 4-O-[2-chloro-4-(4-prop-2-enoyloxybutoxy)phenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-chloro-4-(4-prop-2-enoyloxybutoxy)phenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23529939 |
| Molecular Formula | C30H31ClO9 |
| Molecular Weight | 571.02 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 4-O-[2-chloro-4-(4-prop-2-enoyloxybutoxy)phenyl] 1-O-(4-prop-2-enoyloxyphenyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)C=C)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C30H31ClO9/c1-3-27(32)37-18-6-5-17-36-24-15-16-26(25(31)19-24)40-30(35)21-9-7-20(8-10-21)29(34)39-23-13-11-22(12-14-23)38-28(33)4-2/h3-4,11-16,19-21H,1-2,5-10,17-18H2 |
| InChIKey | JULCKMOZUPMUMZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|