C21H25ClO7 — CID 89122384
[3-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] cyclohexanecarboxylate (PubChem CID 89122384) has the molecular formula C21H25ClO7 and a molecular weight of 424.88 g/mol. Its IUPAC name is [3-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] cyclohexanecarboxylate.
| Compound Name | [3-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 89122384 |
| Molecular Formula | C21H25ClO7 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [3-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] cyclohexanecarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(OC(=O)C2CCCCC2)cc1Cl |
| InChI | InChI=1S/C21H25ClO7/c1-2-19(23)26-12-6-7-13-27-21(25)29-18-11-10-16(14-17(18)22)28-20(24)15-8-4-3-5-9-15/h2,10-11,14-15H,1,3-9,12-13H2 |
| InChIKey | FSUKGORVCQTFMV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|