C30H30Cl2O8 — CID 23529952
bis[2-chloro-4-(2-prop-2-enoyloxyethyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 23529952) has the molecular formula C30H30Cl2O8 and a molecular weight of 589.47 g/mol. Its IUPAC name is bis[2-chloro-4-(2-prop-2-enoyloxyethyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[2-chloro-4-(2-prop-2-enoyloxyethyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23529952 |
| Molecular Formula | C30H30Cl2O8 |
| Molecular Weight | 589.47 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | bis[2-chloro-4-(2-prop-2-enoyloxyethyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(CCOC(=O)C=C)cc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C30H30Cl2O8/c1-3-27(33)37-15-13-19-5-11-25(23(31)17-19)39-29(35)21-7-9-22(10-8-21)30(36)40-26-12-6-20(18-24(26)32)14-16-38-28(34)4-2/h3-6,11-12,17-18,21-22H,1-2,7-10,13-16H2 |
| InChIKey | RNQUJFNROKWGKU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|