C33H40Cl2O8 — CID 23529941
4-O-(2-chloro-4-heptoxyphenyl) 1-O-[2-chloro-4-(2-prop-2-enoyloxyethoxymethyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 23529941) has the molecular formula C33H40Cl2O8 and a molecular weight of 635.58 g/mol. Its IUPAC name is 4-O-(2-chloro-4-heptoxyphenyl) 1-O-[2-chloro-4-(2-prop-2-enoyloxyethoxymethyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-(2-chloro-4-heptoxyphenyl) 1-O-[2-chloro-4-(2-prop-2-enoyloxyethoxymethyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23529941 |
| Molecular Formula | C33H40Cl2O8 |
| Molecular Weight | 635.58 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 4-O-(2-chloro-4-heptoxyphenyl) 1-O-[2-chloro-4-(2-prop-2-enoyloxyethoxymethyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCOCc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OCCCCCCC)cc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C33H40Cl2O8/c1-3-5-6-7-8-17-40-26-14-16-30(28(35)21-26)43-33(38)25-12-10-24(11-13-25)32(37)42-29-15-9-23(20-27(29)34)22-39-18-19-41-31(36)4-2/h4,9,14-16,20-21,24-25H,2-3,5-8,10-13,17-19,22H2,1H3 |
| InChIKey | HSWNLTLCXLNLHX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.58 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|