C36H32Cl2O14 — CID 58722618
bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] benzene-1,4-dicarboxylate (PubChem CID 58722618) has the molecular formula C36H32Cl2O14 and a molecular weight of 759.54 g/mol. Its IUPAC name is bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58722618 |
| Molecular Formula | C36H32Cl2O14 |
| Molecular Weight | 759.54 g/mol |
| Exact Mass | 758.12 |
| IUPAC Name | bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyloxy)phenyl] benzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(OC(=O)OCCCCOC(=O)C=C)cc3Cl)cc2)c(Cl)c1 |
| InChI | InChI=1S/C36H32Cl2O14/c1-3-31(39)45-17-5-7-19-47-35(43)49-25-13-15-29(27(37)21-25)51-33(41)23-9-11-24(12-10-23)34(42)52-30-16-14-26(22-28(30)38)50-36(44)48-20-8-6-18-46-32(40)4-2/h3-4,9-16,21-22H,1-2,5-8,17-20H2 |
| InChIKey | VAKCOAMRGXVLTP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|