C34H33ClO10 — CID 139761029
[3-chloro-4-[4-(2-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 139761029) has the molecular formula C34H33ClO10 and a molecular weight of 637.08 g/mol. Its IUPAC name is [3-chloro-4-[4-(2-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [3-chloro-4-[4-(2-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 139761029 |
| Molecular Formula | C34H33ClO10 |
| Molecular Weight | 637.08 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | [3-chloro-4-[4-(2-prop-2-enoyloxybutoxy)benzoyl]oxyphenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCC(CC)OC(=O)C=C)cc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C34H33ClO10/c1-4-25(43-32(37)6-3)22-42-27-15-11-24(12-16-27)34(39)45-30-18-17-28(21-29(30)35)44-33(38)23-9-13-26(14-10-23)40-19-7-8-20-41-31(36)5-2/h5-6,9-18,21,25H,2-4,7-8,19-20,22H2,1H3 |
| InChIKey | JEFHMHFHJKMAAW-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.08 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|