C52H49ClO14 — CID 18979586
[4-[4-chloro-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 18979586) has the molecular formula C52H49ClO14 and a molecular weight of 933.40 g/mol. Its IUPAC name is [4-[4-chloro-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-[4-chloro-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 18979586 |
| Molecular Formula | C52H49ClO14 |
| Molecular Weight | 933.40 g/mol |
| Exact Mass | 932.28 |
| IUPAC Name | [4-[4-chloro-2-[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxybenzoyl]oxyphenoxy]carbonylphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C(=O)Oc3ccc(Cl)cc3OC(=O)c3ccc(OC(=O)c4ccc(OCCCCCCOC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H49ClO14/c1-3-47(54)62-33-11-7-5-9-31-60-41-22-13-36(14-23-41)49(56)64-43-26-17-38(18-27-43)51(58)66-45-30-21-40(53)35-46(45)67-52(59)39-19-28-44(29-20-39)65-50(57)37-15-24-42(25-16-37)61-32-10-6-8-12-34-63-48(55)4-2/h3-4,13-30,35H,1-2,5-12,31-34H2 |
| InChIKey | DXHKNNIOTXLEPS-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.40 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|