C45H55NO13 — CID 134189524
4-O-[2-methanimidoyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 134189524) has the molecular formula C45H55NO13 and a molecular weight of 817.93 g/mol. Its IUPAC name is 4-O-[2-methanimidoyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[2-methanimidoyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134189524 |
| Molecular Formula | C45H55NO13 |
| Molecular Weight | 817.93 g/mol |
| Exact Mass | 817.37 |
| IUPAC Name | 4-O-[2-methanimidoyl-4-[4-[4-(6-prop-2-enoyloxyhexoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | [H]/N=C/c1cc(OC(=O)C2CCC(C(=O)Oc3ccc(OCCCCCCOC(=O)C=C)cc3)CC2)ccc1OC(=O)C1CCC(C(=O)OCCCCOC(=O)C=C)CC1 |
| InChI | InChI=1S/C45H55NO13/c1-3-40(47)54-26-8-6-5-7-25-53-36-19-21-37(22-20-36)57-43(50)32-15-17-33(18-16-32)44(51)58-38-23-24-39(35(29-38)30-46)59-45(52)34-13-11-31(12-14-34)42(49)56-28-10-9-27-55-41(48)4-2/h3-4,19-24,29-34,46H,1-2,5-18,25-28H2/b46-30+ |
| InChIKey | JNGXNVRHIFQVIP-MCQKKTSZSA-N |
| XLogP | 7.43 |
| TPSA | 190.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.93 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|