C46H65NO6 — CID 153435634
[4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[[4-[4-(4-butylcyclohexyl)cyclohexyl]-2-methanimidoylphenoxy]methyl]cyclohexane-1-carboxylate (PubChem CID 153435634) has the molecular formula C46H65NO6 and a molecular weight of 728.03 g/mol. Its IUPAC name is [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[[4-[4-(4-butylcyclohexyl)cyclohexyl]-2-methanimidoylphenoxy]methyl]cyclohexane-1-carboxylate.
| Compound Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[[4-[4-(4-butylcyclohexyl)cyclohexyl]-2-methanimidoylphenoxy]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 153435634 |
| Molecular Formula | C46H65NO6 |
| Molecular Weight | 728.03 g/mol |
| Exact Mass | 727.48 |
| IUPAC Name | [4-(6-prop-2-enoyloxyhexoxy)phenyl] 4-[[4-[4-(4-butylcyclohexyl)cyclohexyl]-2-methanimidoylphenoxy]methyl]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C/c1cc(C2CCC(C3CCC(CCCC)CC3)CC2)ccc1OCC1CCC(C(=O)Oc2ccc(OCCCCCCOC(=O)C=C)cc2)CC1 |
| InChI | InChI=1S/C46H65NO6/c1-3-5-10-34-11-15-36(16-12-34)37-19-21-38(22-20-37)40-23-28-44(41(31-40)32-47)52-33-35-13-17-39(18-14-35)46(49)53-43-26-24-42(25-27-43)50-29-8-6-7-9-30-51-45(48)4-2/h4,23-28,31-32,34-39,47H,2-3,5-22,29-30,33H2,1H3/b47-32+ |
| InChIKey | JPRHZXYEEAXXLH-IUQVKIOSSA-N |
| XLogP | 11.41 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.03 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|